C13H17FN4O2S — CID 106018108
4-fluoro-N-(2-imidazol-1-ylethyl)-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 106018108) has the molecular formula C13H17FN4O2S and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-fluoro-N-(2-imidazol-1-ylethyl)-3-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-imidazol-1-ylethyl)-3-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106018108 |
| Molecular Formula | C13H17FN4O2S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-fluoro-N-(2-imidazol-1-ylethyl)-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCCn2ccnc2)ccc1F |
| InChI | InChI=1S/C13H17FN4O2S/c1-15-9-11-8-12(2-3-13(11)14)21(19,20)17-5-7-18-6-4-16-10-18/h2-4,6,8,10,15,17H,5,7,9H2,1H3 |
| InChIKey | FRKSWPYSDQEAMQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |