C12H15BrF3NO2S — CID 114297627
N-(3-bromobutyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 114297627) has the molecular formula C12H15BrF3NO2S and a molecular weight of 374.22 g/mol. Its IUPAC name is N-(3-bromobutyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-bromobutyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114297627 |
| Molecular Formula | C12H15BrF3NO2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-(3-bromobutyl)-2-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1c(C(F)(F)F)cccc1S(=O)(=O)NCCC(C)Br |
| InChI | InChI=1S/C12H15BrF3NO2S/c1-8(13)6-7-17-20(18,19)11-5-3-4-10(9(11)2)12(14,15)16/h3-5,8,17H,6-7H2,1-2H3 |
| InChIKey | VKBLYGQCPSHJKF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|