C10H10ClN5O2S — CID 76924210
2-(4-chlorophenyl)-N-(2H-tetrazol-5-ylmethyl)ethenesulfonamide (PubChem CID 76924210) has the molecular formula C10H10ClN5O2S and a molecular weight of 299.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2H-tetrazol-5-ylmethyl)ethenesulfonamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2H-tetrazol-5-ylmethyl)ethenesulfonamide |
|---|---|
| PubChem CID | 76924210 |
| Molecular Formula | C10H10ClN5O2S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2H-tetrazol-5-ylmethyl)ethenesulfonamide |
| SMILES | O=S(=O)(C=Cc1ccc(Cl)cc1)NCc1nn[nH]n1 |
| InChI | InChI=1S/C10H10ClN5O2S/c11-9-3-1-8(2-4-9)5-6-19(17,18)12-7-10-13-15-16-14-10/h1-6,12H,7H2,(H,13,14,15,16) |
| InChIKey | JCUDGDYNFAUBGX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |