C8H5F3N3O3- — CID 151382007
2-oxo-2-[2-[5-(trifluoromethyl)-2-pyridinyl]hydrazinyl]acetate (PubChem CID 151382007) has the molecular formula C8H5F3N3O3- and a molecular weight of 248.14 g/mol. Its IUPAC name is 2-oxo-2-[2-[5-(trifluoromethyl)-2-pyridinyl]hydrazinyl]acetate.
| Compound Name | 2-oxo-2-[2-[5-(trifluoromethyl)-2-pyridinyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 151382007 |
| Molecular Formula | C8H5F3N3O3- |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-oxo-2-[2-[5-(trifluoromethyl)-2-pyridinyl]hydrazinyl]acetate |
| SMILES | O=C([O-])C(=O)NNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C8H6F3N3O3/c9-8(10,11)4-1-2-5(12-3-4)13-14-6(15)7(16)17/h1-3H,(H,12,13)(H,14,15)(H,16,17)/p-1 |
| InChIKey | OSPNNLBSYXBUMP-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|