C16H18F3N3O2S — CID 8505628
4-tert-butyl-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide (PubChem CID 8505628) has the molecular formula C16H18F3N3O2S and a molecular weight of 373.40 g/mol. Its IUPAC name is 4-tert-butyl-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide.
| Compound Name | 4-tert-butyl-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 8505628 |
| Molecular Formula | C16H18F3N3O2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-tert-butyl-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NNc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C16H18F3N3O2S/c1-15(2,3)11-4-7-13(8-5-11)25(23,24)22-21-14-9-6-12(10-20-14)16(17,18)19/h4-10,22H,1-3H3,(H,20,21) |
| InChIKey | FSEPAFAPVVQCIO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|