C14H14F3N3O4S — CID 8505651
2,5-dimethoxy-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide (PubChem CID 8505651) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is 2,5-dimethoxy-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide.
| Compound Name | 2,5-dimethoxy-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 8505651 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2,5-dimethoxy-N'-[5-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NNc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C14H14F3N3O4S/c1-23-10-4-5-11(24-2)12(7-10)25(21,22)20-19-13-6-3-9(8-18-13)14(15,16)17/h3-8,20H,1-2H3,(H,18,19) |
| InChIKey | GDGGWXMUPGOXQD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|