C11H10Cl3NO4 — CID 167971023
(2R)-2-[(2,3,5-trichlorophenyl)methylamino]butanedioic acid (PubChem CID 167971023) has the molecular formula C11H10Cl3NO4 and a molecular weight of 326.56 g/mol. Its IUPAC name is (2R)-2-[(2,3,5-trichlorophenyl)methylamino]butanedioic acid.
| Compound Name | (2R)-2-[(2,3,5-trichlorophenyl)methylamino]butanedioic acid |
|---|---|
| PubChem CID | 167971023 |
| Molecular Formula | C11H10Cl3NO4 |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | (2R)-2-[(2,3,5-trichlorophenyl)methylamino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NCc1cc(Cl)cc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C11H10Cl3NO4/c12-6-1-5(10(14)7(13)2-6)4-15-8(11(18)19)3-9(16)17/h1-2,8,15H,3-4H2,(H,16,17)(H,18,19)/t8-/m1/s1 |
| InChIKey | KMGSOYAUINWSAI-MRVPVSSYSA-N |
| XLogP | 2.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|