C11H10Cl2F3NO3 — CID 167805745
2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-4,4,4-trifluorobutanoic acid (PubChem CID 167805745) has the molecular formula C11H10Cl2F3NO3 and a molecular weight of 332.11 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 167805745 |
| Molecular Formula | C11H10Cl2F3NO3 |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)C(CC(F)(F)F)NCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C11H10Cl2F3NO3/c12-6-1-5(9(18)7(13)2-6)4-17-8(10(19)20)3-11(14,15)16/h1-2,8,17-18H,3-4H2,(H,19,20) |
| InChIKey | NCYCEUQRTNUFIP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|