C14H11Cl2NO4 — CID 86294575
3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-5-hydroxybenzoic acid (PubChem CID 86294575) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-5-hydroxybenzoic acid.
| Compound Name | 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 86294575 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)cc(NCc2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C14H11Cl2NO4/c15-9-1-8(13(19)12(16)4-9)6-17-10-2-7(14(20)21)3-11(18)5-10/h1-5,17-19H,6H2,(H,20,21) |
| InChIKey | PFQMBJMPTDZKCH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|