C13H16ClF2NO5S — CID 122101400
2-[[5-chloro-2-(difluoromethoxy)phenyl]sulfonylamino]hexanoic acid (PubChem CID 122101400) has the molecular formula C13H16ClF2NO5S and a molecular weight of 371.79 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]sulfonylamino]hexanoic acid.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 122101400 |
| Molecular Formula | C13H16ClF2NO5S |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]sulfonylamino]hexanoic acid |
| SMILES | CCCCC(NS(=O)(=O)c1cc(Cl)ccc1OC(F)F)C(=O)O |
| InChI | InChI=1S/C13H16ClF2NO5S/c1-2-3-4-9(12(18)19)17-23(20,21)11-7-8(14)5-6-10(11)22-13(15)16/h5-7,9,13,17H,2-4H2,1H3,(H,18,19) |
| InChIKey | NDSIZVYQQASTQG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |