C14H24N4O3S2 — CID 100566599
N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 100566599) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100566599 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[5-(cyclohexylmethylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nnc(S(=O)(=O)NCC2CCCCC2)s1 |
| InChI | InChI=1S/C14H24N4O3S2/c1-14(2,3)11(19)16-12-17-18-13(22-12)23(20,21)15-9-10-7-5-4-6-8-10/h10,15H,4-9H2,1-3H3,(H,16,17,19) |
| InChIKey | VHOZMQLRJOSEAU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|