C15H19FN4O4S2 — CID 100563526
N-[5-[2-(4-fluorophenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 100563526) has the molecular formula C15H19FN4O4S2 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[5-[2-(4-fluorophenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[2-(4-fluorophenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100563526 |
| Molecular Formula | C15H19FN4O4S2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-[5-[2-(4-fluorophenoxy)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nnc(S(=O)(=O)NCCOc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H19FN4O4S2/c1-15(2,3)12(21)18-13-19-20-14(25-13)26(22,23)17-8-9-24-11-6-4-10(16)5-7-11/h4-7,17H,8-9H2,1-3H3,(H,18,19,21) |
| InChIKey | NKKQHTPRYPGFMY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|