C22H17ClN6O4S2 — CID 100648223
2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 100648223) has the molecular formula C22H17ClN6O4S2 and a molecular weight of 529.00 g/mol. Its IUPAC name is 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 100648223 |
| Molecular Formula | C22H17ClN6O4S2 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 2-[[5-[(2-chlorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfonylamino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)Nc2ccccc2C(=O)NCc2cccnc2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN6O4S2/c23-17-9-3-1-7-15(17)20(31)26-21-27-28-22(34-21)35(32,33)29-18-10-4-2-8-16(18)19(30)25-13-14-6-5-11-24-12-14/h1-12,29H,13H2,(H,25,30)(H,26,27,31) |
| InChIKey | BJGUCNOXZAGGOX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 143.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|