C21H23N5O5S2 — CID 100535795
N-[5-[[2-(3-methoxypropylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 100535795) has the molecular formula C21H23N5O5S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[5-[[2-(3-methoxypropylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[[2-(3-methoxypropylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 100535795 |
| Molecular Formula | C21H23N5O5S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-[5-[[2-(3-methoxypropylcarbamoyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | COCCCNC(=O)c1ccccc1NS(=O)(=O)c1nnc(NC(=O)c2ccccc2C)s1 |
| InChI | InChI=1S/C21H23N5O5S2/c1-14-8-3-4-9-15(14)19(28)23-20-24-25-21(32-20)33(29,30)26-17-11-6-5-10-16(17)18(27)22-12-7-13-31-2/h3-6,8-11,26H,7,12-13H2,1-2H3,(H,22,27)(H,23,24,28) |
| InChIKey | XSVHCENWOHVTJC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|