C19H16N6O4S3 — CID 100505726
N-[5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 100505726) has the molecular formula C19H16N6O4S3 and a molecular weight of 488.58 g/mol. Its IUPAC name is N-[5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 100505726 |
| Molecular Formula | C19H16N6O4S3 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | N-[5-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | COc1ccc(-c2nnc(NS(=O)(=O)c3nnc(NC(=O)c4ccccc4C)s3)s2)cc1 |
| InChI | InChI=1S/C19H16N6O4S3/c1-11-5-3-4-6-14(11)15(26)20-17-22-24-19(31-17)32(27,28)25-18-23-21-16(30-18)12-7-9-13(29-2)10-8-12/h3-10H,1-2H3,(H,23,25)(H,20,22,26) |
| InChIKey | HNRZFHZUMPOZDG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 136.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|