C17H14N4O5S2 — CID 100517295
N-[5-(1,3-benzodioxol-5-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 100517295) has the molecular formula C17H14N4O5S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 100517295 |
| Molecular Formula | C17H14N4O5S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nnc(S(=O)(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C17H14N4O5S2/c1-10-4-2-3-5-12(10)15(22)18-16-19-20-17(27-16)28(23,24)21-11-6-7-13-14(8-11)26-9-25-13/h2-8,21H,9H2,1H3,(H,18,19,22) |
| InChIKey | RFJUFYGBPYUUEG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|