C19H20N4O5S3 — CID 133187262
N-[5-[1-(4-methylsulfonylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133187262) has the molecular formula C19H20N4O5S3 and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[5-[1-(4-methylsulfonylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[1-(4-methylsulfonylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133187262 |
| Molecular Formula | C19H20N4O5S3 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-[5-[1-(4-methylsulfonylphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCC(NS(=O)(=O)c1nnc(NC(=O)c2ccccc2)s1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20N4O5S3/c1-3-16(13-9-11-15(12-10-13)30(2,25)26)23-31(27,28)19-22-21-18(29-19)20-17(24)14-7-5-4-6-8-14/h4-12,16,23H,3H2,1-2H3,(H,20,21,24) |
| InChIKey | YHYWBIOXAYCMMZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|