C26H28N2O2S2 — CID 100722579
1-[(4R)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100722579) has the molecular formula C26H28N2O2S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 1-[(4R)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(4R)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100722579 |
| Molecular Formula | C26H28N2O2S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[(4R)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | COc1ccc2c(c1)OC(C)(C)C[C@H]2NC(=S)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O2S2/c1-26(2)16-23(22-14-13-20(29-3)15-24(22)30-26)28-25(31)27-19-11-9-18(10-12-19)17-32-21-7-5-4-6-8-21/h4-15,23H,16-17H2,1-3H3,(H2,27,28,31)/t23-/m1/s1 |
| InChIKey | JSIKJSIKDINNOZ-HSZRJFAPSA-N |
| XLogP | 6.58 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|