C24H22ClFN2O3S — CID 100669714
ethyl 2-chloro-4-[[4-[(4-fluorophenyl)methoxy]phenyl]methylcarbamothioylamino]benzoate (PubChem CID 100669714) has the molecular formula C24H22ClFN2O3S and a molecular weight of 472.97 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[4-[(4-fluorophenyl)methoxy]phenyl]methylcarbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[4-[(4-fluorophenyl)methoxy]phenyl]methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100669714 |
| Molecular Formula | C24H22ClFN2O3S |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | ethyl 2-chloro-4-[[4-[(4-fluorophenyl)methoxy]phenyl]methylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NCc2ccc(OCc3ccc(F)cc3)cc2)cc1Cl |
| InChI | InChI=1S/C24H22ClFN2O3S/c1-2-30-23(29)21-12-9-19(13-22(21)25)28-24(32)27-14-16-5-10-20(11-6-16)31-15-17-3-7-18(26)8-4-17/h3-13H,2,14-15H2,1H3,(H2,27,28,32) |
| InChIKey | QLIRLIKSUAIRRP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|