C21H27N3O3S — CID 100754580
ethyl 3-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate (PubChem CID 100754580) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is ethyl 3-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate.
| Compound Name | ethyl 3-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100754580 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | ethyl 3-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=S)NCCN(C)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-5-27-20(25)16-7-6-15(2)19(14-16)23-21(28)22-12-13-24(3)17-8-10-18(26-4)11-9-17/h6-11,14H,5,12-13H2,1-4H3,(H2,22,23,28) |
| InChIKey | LFALJUZNDSEJOO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|