C22H29N3O2S — CID 100753438
ethyl 3-[2-(N-ethyl-4-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate (PubChem CID 100753438) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is ethyl 3-[2-(N-ethyl-4-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate.
| Compound Name | ethyl 3-[2-(N-ethyl-4-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100753438 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | ethyl 3-[2-(N-ethyl-4-methylanilino)ethylcarbamothioylamino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=S)NCCN(CC)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H29N3O2S/c1-5-25(19-11-7-16(3)8-12-19)14-13-23-22(28)24-20-15-18(10-9-17(20)4)21(26)27-6-2/h7-12,15H,5-6,13-14H2,1-4H3,(H2,23,24,28) |
| InChIKey | JCWALJJZBSKQAU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|