C18H21BrFN3S — CID 100753377
1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea (PubChem CID 100753377) has the molecular formula C18H21BrFN3S and a molecular weight of 410.36 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea |
|---|---|
| PubChem CID | 100753377 |
| Molecular Formula | C18H21BrFN3S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea |
| SMILES | CCN(CCNC(=S)Nc1ccc(Br)cc1F)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21BrFN3S/c1-3-23(15-7-4-13(2)5-8-15)11-10-21-18(24)22-17-9-6-14(19)12-16(17)20/h4-9,12H,3,10-11H2,1-2H3,(H2,21,22,24) |
| InChIKey | HSOBOJRSRGYYPY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|