C18H21BrFN3O — CID 3339643
1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea (PubChem CID 3339643) has the molecular formula C18H21BrFN3O and a molecular weight of 394.29 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
|---|---|
| PubChem CID | 3339643 |
| Molecular Formula | C18H21BrFN3O |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
| SMILES | CCN(CCNC(=O)Nc1ccc(Br)cc1F)c1cccc(C)c1 |
| InChI | InChI=1S/C18H21BrFN3O/c1-3-23(15-6-4-5-13(2)11-15)10-9-21-18(24)22-17-8-7-14(19)12-16(17)20/h4-8,11-12H,3,9-10H2,1-2H3,(H2,21,22,24) |
| InChIKey | WCCJDVXPDHWOAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |