C22H31N3O — CID 3741166
1-(2,6-diethylphenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea (PubChem CID 3741166) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
|---|---|
| PubChem CID | 3741166 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)NCCN(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C22H31N3O/c1-5-18-11-9-12-19(6-2)21(18)24-22(26)23-14-15-25(7-3)20-13-8-10-17(4)16-20/h8-13,16H,5-7,14-15H2,1-4H3,(H2,23,24,26) |
| InChIKey | CCRYZIBCEMOTSI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |