C18H22BrN3O — CID 3498030
1-(3-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea (PubChem CID 3498030) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea.
| Compound Name | 1-(3-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
|---|---|
| PubChem CID | 3498030 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(3-bromophenyl)-3-[2-(N-ethyl-3-methylanilino)ethyl]urea |
| SMILES | CCN(CCNC(=O)Nc1cccc(Br)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C18H22BrN3O/c1-3-22(17-9-4-6-14(2)12-17)11-10-20-18(23)21-16-8-5-7-15(19)13-16/h4-9,12-13H,3,10-11H2,1-2H3,(H2,20,21,23) |
| InChIKey | XSTKCCPTPVWRJB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |