C19H24FN3S — CID 53364968
1-[4-(diethylamino)-2-methylphenyl]-3-(2-fluoro-4-methylphenyl)thiourea (PubChem CID 53364968) has the molecular formula C19H24FN3S and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-(2-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(2-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 53364968 |
| Molecular Formula | C19H24FN3S |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(2-fluoro-4-methylphenyl)thiourea |
| SMILES | CCN(CC)c1ccc(NC(=S)Nc2ccc(C)cc2F)c(C)c1 |
| InChI | InChI=1S/C19H24FN3S/c1-5-23(6-2)15-8-10-17(14(4)12-15)21-19(24)22-18-9-7-13(3)11-16(18)20/h7-12H,5-6H2,1-4H3,(H2,21,22,24) |
| InChIKey | HHINRXFCVSZGDK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|