C21H26N2O4S — CID 100748188
ethyl 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamothioylamino]-4-methylbenzoate (PubChem CID 100748188) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is ethyl 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamothioylamino]-4-methylbenzoate.
| Compound Name | ethyl 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100748188 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 3-[(3-ethoxy-4-methoxyphenyl)methylcarbamothioylamino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=S)NCc2ccc(OC)c(OCC)c2)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-5-26-19-11-15(8-10-18(19)25-4)13-22-21(28)23-17-12-16(9-7-14(17)3)20(24)27-6-2/h7-12H,5-6,13H2,1-4H3,(H2,22,23,28) |
| InChIKey | YUJUMVPYSQHPMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|