C19H32N4O2S2 — CID 133154559
1-[3-(2-ethylpiperidin-1-yl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 133154559) has the molecular formula C19H32N4O2S2 and a molecular weight of 412.63 g/mol. Its IUPAC name is 1-[3-(2-ethylpiperidin-1-yl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-[3-(2-ethylpiperidin-1-yl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 133154559 |
| Molecular Formula | C19H32N4O2S2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[3-(2-ethylpiperidin-1-yl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | CCC1CCCCN1CCCNC(=S)Nc1cccc(N(C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H32N4O2S2/c1-4-17-10-5-6-13-23(17)14-8-12-20-19(26)21-16-9-7-11-18(15-16)22(2)27(3,24)25/h7,9,11,15,17H,4-6,8,10,12-14H2,1-3H3,(H2,20,21,26) |
| InChIKey | VZLBWVKGCRGUDY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|