C17H18BrFN2S2 — CID 100698530
1-(3-bromophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea (PubChem CID 100698530) has the molecular formula C17H18BrFN2S2 and a molecular weight of 413.38 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea |
|---|---|
| PubChem CID | 100698530 |
| Molecular Formula | C17H18BrFN2S2 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1-(3-bromophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea |
| SMILES | Fc1ccc(CSCCCNC(=S)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C17H18BrFN2S2/c18-14-3-1-4-16(11-14)21-17(22)20-9-2-10-23-12-13-5-7-15(19)8-6-13/h1,3-8,11H,2,9-10,12H2,(H2,20,21,22) |
| InChIKey | MGXWGEZMLGNMFS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|