C15H20BrFN2S2 — CID 100602819
1-(4-bromo-2-fluorophenyl)-3-(2-cyclohexylsulfanylethyl)thiourea (PubChem CID 100602819) has the molecular formula C15H20BrFN2S2 and a molecular weight of 391.38 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(2-cyclohexylsulfanylethyl)thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(2-cyclohexylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 100602819 |
| Molecular Formula | C15H20BrFN2S2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(2-cyclohexylsulfanylethyl)thiourea |
| SMILES | Fc1cc(Br)ccc1NC(=S)NCCSC1CCCCC1 |
| InChI | InChI=1S/C15H20BrFN2S2/c16-11-6-7-14(13(17)10-11)19-15(20)18-8-9-21-12-4-2-1-3-5-12/h6-7,10,12H,1-5,8-9H2,(H2,18,19,20) |
| InChIKey | DCGGLBVFAPVARA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|