C23H20FN3O3 — CID 42961337
N-(2,5-dioxo-3-phenylpyrrolidin-1-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 42961337) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is N-(2,5-dioxo-3-phenylpyrrolidin-1-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-(2,5-dioxo-3-phenylpyrrolidin-1-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42961337 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(2,5-dioxo-3-phenylpyrrolidin-1-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NN2C(=O)CC(c3ccccc3)C2=O)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FN3O3/c1-14-12-19(15(2)26(14)18-10-8-17(24)9-11-18)22(29)25-27-21(28)13-20(23(27)30)16-6-4-3-5-7-16/h3-12,20H,13H2,1-2H3,(H,25,29) |
| InChIKey | CJMATBKPCBXGDL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|