C22H24FN5O4 — CID 25329739
N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide (PubChem CID 25329739) has the molecular formula C22H24FN5O4 and a molecular weight of 441.46 g/mol. Its IUPAC name is N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide.
| Compound Name | N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 25329739 |
| Molecular Formula | C22H24FN5O4 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)CN2C(=O)NC3(CCCC3)C2=O)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN5O4/c1-13-11-17(14(2)28(13)16-7-5-15(23)6-8-16)19(30)26-25-18(29)12-27-20(31)22(24-21(27)32)9-3-4-10-22/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,24,32)(H,25,29)(H,26,30) |
| InChIKey | CMMPQHJJVAYYKP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|