C24H32ClN3O2 — CID 47068222
1-[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-N-(3-methylbutyl)piperidine-4-carboxamide (PubChem CID 47068222) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-N-(3-methylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-N-(3-methylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47068222 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-N-(3-methylbutyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCC(C(=O)NCCC(C)C)CC2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN3O2/c1-16(2)9-12-26-23(29)19-10-13-27(14-11-19)24(30)22-15-17(3)28(18(22)4)21-7-5-20(25)6-8-21/h5-8,15-16,19H,9-14H2,1-4H3,(H,26,29) |
| InChIKey | YYDKDETYLHWJNU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|