C24H32FN3O3 — CID 78871300
N-(3-ethoxypropyl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide (PubChem CID 78871300) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78871300 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)c2cc(C)n(-c3ccccc3F)c2C)CC1 |
| InChI | InChI=1S/C24H32FN3O3/c1-4-31-15-7-12-26-23(29)19-10-13-27(14-11-19)24(30)20-16-17(2)28(18(20)3)22-9-6-5-8-21(22)25/h5-6,8-9,16,19H,4,7,10-15H2,1-3H3,(H,26,29) |
| InChIKey | SWCRLJXETYZQSP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|