C22H29FN2O4S — CID 78867841
N-(3-ethoxypropyl)-1-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]piperidine-4-carboxamide (PubChem CID 78867841) has the molecular formula C22H29FN2O4S and a molecular weight of 436.55 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78867841 |
| Molecular Formula | C22H29FN2O4S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)c2sc3cccc(F)c3c2COC)CC1 |
| InChI | InChI=1S/C22H29FN2O4S/c1-3-29-13-5-10-24-21(26)15-8-11-25(12-9-15)22(27)20-16(14-28-2)19-17(23)6-4-7-18(19)30-20/h4,6-7,15H,3,5,8-14H2,1-2H3,(H,24,26) |
| InChIKey | QZJVCKBQENWMOG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|