C21H30N4O3S — CID 78900547
1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbonyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 78900547) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbonyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbonyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78900547 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbonyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)c2cc(C)n(-c3nccs3)c2C)CC1 |
| InChI | InChI=1S/C21H30N4O3S/c1-4-28-12-5-8-22-19(26)17-6-10-24(11-7-17)20(27)18-14-15(2)25(16(18)3)21-23-9-13-29-21/h9,13-14,17H,4-8,10-12H2,1-3H3,(H,22,26) |
| InChIKey | LQNWWPJOMFLNDY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|