C20H19ClN2OS — CID 3007472
1-[1-[2-[3-(4-chlorophenyl)sulfanylpropoxy]phenyl]ethenyl]imidazole (PubChem CID 3007472) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is 1-[1-[2-[3-(4-chlorophenyl)sulfanylpropoxy]phenyl]ethenyl]imidazole.
| Compound Name | 1-[1-[2-[3-(4-chlorophenyl)sulfanylpropoxy]phenyl]ethenyl]imidazole |
|---|---|
| PubChem CID | 3007472 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[1-[2-[3-(4-chlorophenyl)sulfanylpropoxy]phenyl]ethenyl]imidazole |
| SMILES | C=C(c1ccccc1OCCCSc1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-16(23-12-11-22-15-23)19-5-2-3-6-20(19)24-13-4-14-25-18-9-7-17(21)8-10-18/h2-3,5-12,15H,1,4,13-14H2 |
| InChIKey | SDDSFYBUEPYDFE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|