C17H16Cl2N2OS — CID 151987624
1-[1-[2-[2-(2,4-dichloro-3H-thiophen-2-yl)ethoxy]phenyl]ethenyl]imidazole (PubChem CID 151987624) has the molecular formula C17H16Cl2N2OS and a molecular weight of 367.30 g/mol. Its IUPAC name is 1-[1-[2-[2-(2,4-dichloro-3H-thiophen-2-yl)ethoxy]phenyl]ethenyl]imidazole.
| Compound Name | 1-[1-[2-[2-(2,4-dichloro-3H-thiophen-2-yl)ethoxy]phenyl]ethenyl]imidazole |
|---|---|
| PubChem CID | 151987624 |
| Molecular Formula | C17H16Cl2N2OS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-[1-[2-[2-(2,4-dichloro-3H-thiophen-2-yl)ethoxy]phenyl]ethenyl]imidazole |
| SMILES | C=C(c1ccccc1OCCC1(Cl)CC(Cl)=CS1)n1ccnc1 |
| InChI | InChI=1S/C17H16Cl2N2OS/c1-13(21-8-7-20-12-21)15-4-2-3-5-16(15)22-9-6-17(19)10-14(18)11-23-17/h2-5,7-8,11-12H,1,6,9-10H2 |
| InChIKey | UDZMJJQYCZBEQR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|