C24H19NO5 — CID 19371200
methyl 2-[2-[4-(1-benzofuran-2-yl)anilino]-2-oxoethoxy]benzoate (PubChem CID 19371200) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is methyl 2-[2-[4-(1-benzofuran-2-yl)anilino]-2-oxoethoxy]benzoate.
| Compound Name | methyl 2-[2-[4-(1-benzofuran-2-yl)anilino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 19371200 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | methyl 2-[2-[4-(1-benzofuran-2-yl)anilino]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccccc1OCC(=O)Nc1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C24H19NO5/c1-28-24(27)19-7-3-5-9-21(19)29-15-23(26)25-18-12-10-16(11-13-18)22-14-17-6-2-4-8-20(17)30-22/h2-14H,15H2,1H3,(H,25,26) |
| InChIKey | HMGOVMSAUUGNKZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |