C27H20N2O4 — CID 22780436
N-[4-[(2-naphthalen-1-yloxyacetyl)amino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 22780436) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[4-[(2-naphthalen-1-yloxyacetyl)amino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(2-naphthalen-1-yloxyacetyl)amino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 22780436 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[4-[(2-naphthalen-1-yloxyacetyl)amino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(COc1cccc2ccccc12)Nc1ccc(NC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C27H20N2O4/c30-26(17-32-24-11-5-8-18-6-1-3-9-22(18)24)28-20-12-14-21(15-13-20)29-27(31)25-16-19-7-2-4-10-23(19)33-25/h1-16H,17H2,(H,28,30)(H,29,31) |
| InChIKey | NKRLGOIWOYMYPD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |