C24H19BrN2O3 — CID 60571787
N-[4-[2-[(3-bromophenyl)methylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 60571787) has the molecular formula C24H19BrN2O3 and a molecular weight of 463.33 g/mol. Its IUPAC name is N-[4-[2-[(3-bromophenyl)methylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[2-[(3-bromophenyl)methylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 60571787 |
| Molecular Formula | C24H19BrN2O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[4-[2-[(3-bromophenyl)methylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Cc1ccc(NC(=O)c2cc3ccccc3o2)cc1)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C24H19BrN2O3/c25-19-6-3-4-17(12-19)15-26-23(28)13-16-8-10-20(11-9-16)27-24(29)22-14-18-5-1-2-7-21(18)30-22/h1-12,14H,13,15H2,(H,26,28)(H,27,29) |
| InChIKey | PKXUUPTVAGXKML-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |