C24H23N3O5 — CID 56559124
N-[4-[2-[3-(2,5-dioxopyrrolidin-1-yl)propylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 56559124) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[4-[2-[3-(2,5-dioxopyrrolidin-1-yl)propylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[2-[3-(2,5-dioxopyrrolidin-1-yl)propylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 56559124 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[4-[2-[3-(2,5-dioxopyrrolidin-1-yl)propylamino]-2-oxoethyl]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Cc1ccc(NC(=O)c2cc3ccccc3o2)cc1)NCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C24H23N3O5/c28-21(25-12-3-13-27-22(29)10-11-23(27)30)14-16-6-8-18(9-7-16)26-24(31)20-15-17-4-1-2-5-19(17)32-20/h1-2,4-9,15H,3,10-14H2,(H,25,28)(H,26,31) |
| InChIKey | SDGMUWWGPLOGIL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|