C23H25N3O3 — CID 119536846
N-[4-[2-oxo-2-(2-pyrrolidin-3-ylethylamino)ethyl]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 119536846) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(2-pyrrolidin-3-ylethylamino)ethyl]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[2-oxo-2-(2-pyrrolidin-3-ylethylamino)ethyl]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 119536846 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[4-[2-oxo-2-(2-pyrrolidin-3-ylethylamino)ethyl]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Cc1ccc(NC(=O)c2cc3ccccc3o2)cc1)NCCC1CCNC1 |
| InChI | InChI=1S/C23H25N3O3/c27-22(25-12-10-17-9-11-24-15-17)13-16-5-7-19(8-6-16)26-23(28)21-14-18-3-1-2-4-20(18)29-21/h1-8,14,17,24H,9-13,15H2,(H,25,27)(H,26,28) |
| InChIKey | HEYSQQXNUPJIDE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |