C20H24N2O3 — CID 7857667
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-anilinobenzoate (PubChem CID 7857667) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-anilinobenzoate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-anilinobenzoate |
|---|---|
| PubChem CID | 7857667 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-anilinobenzoate |
| SMILES | CC(C)[C@@H](C)NC(=O)COC(=O)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-14(2)15(3)21-19(23)13-25-20(24)17-11-7-8-12-18(17)22-16-9-5-4-6-10-16/h4-12,14-15,22H,13H2,1-3H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | QFVFJSLDJZLNSC-OAHLLOKOSA-N |
| XLogP | 3.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |