C22H19F2N3O2S — CID 112767366
2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(methylcarbamoyl)phenyl]benzamide (PubChem CID 112767366) has the molecular formula C22H19F2N3O2S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 112767366 |
| Molecular Formula | C22H19F2N3O2S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2ccccc2Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C22H19F2N3O2S/c1-25-20(28)14-5-4-6-16(13-14)27-21(29)18-7-2-3-8-19(18)26-15-9-11-17(12-10-15)30-22(23)24/h2-13,22,26H,1H3,(H,25,28)(H,27,29) |
| InChIKey | FOILIGCEUVIAQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |