C22H21F2N3O3S2 — CID 2539246
2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 2539246) has the molecular formula C22H21F2N3O3S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 2539246 |
| Molecular Formula | C22H21F2N3O3S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccccc2Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H21F2N3O3S2/c23-22(24)31-17-9-7-16(8-10-17)27-20-4-2-1-3-19(20)21(28)26-14-13-15-5-11-18(12-6-15)32(25,29)30/h1-12,22,27H,13-14H2,(H,26,28)(H2,25,29,30) |
| InChIKey | RLDCGZRUKZPAFZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |