C13H15N3O7 — CID 124928350
methyl 2-[2-[(2-hydroxyethoxycarbonylamino)carbamoyl]anilino]-2-oxoacetate (PubChem CID 124928350) has the molecular formula C13H15N3O7 and a molecular weight of 325.28 g/mol. Its IUPAC name is methyl 2-[2-[(2-hydroxyethoxycarbonylamino)carbamoyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[2-[(2-hydroxyethoxycarbonylamino)carbamoyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 124928350 |
| Molecular Formula | C13H15N3O7 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | methyl 2-[2-[(2-hydroxyethoxycarbonylamino)carbamoyl]anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccccc1C(=O)NNC(=O)OCCO |
| InChI | InChI=1S/C13H15N3O7/c1-22-12(20)11(19)14-9-5-3-2-4-8(9)10(18)15-16-13(21)23-7-6-17/h2-5,17H,6-7H2,1H3,(H,14,19)(H,15,18)(H,16,21) |
| InChIKey | YBMKUGORDLRUFS-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|