About 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol)
2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) (PubChem CID 69498053) has the molecular formula C19H38N4O9
and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol).
Molecular Properties
| Compound Name | 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) |
| PubChem CID | 69498053 |
| Molecular Formula | C19H38N4O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) |
| SMILES | NNC(=O)c1ccccc1NN.OCCOCCOCCO.OCCOCCOCCO |
| InChI | InChI=1S/C7H10N4O.2C6H14O4/c8-10-6-4-2-1-3-5(6)7(12)11-9;2*7-1-3-9-5-6-10-4-2-8/h1-4,10H,8-9H2,(H,11,12);2*7-8H,1-6H2 |
| InChIKey | MHOXNUGZOGMCKF-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 211.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol)?
The IUPAC name of 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) (CID 69498053) is 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol).
What is the SMILES notation for 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol)?
The canonical SMILES for 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) is NNC(=O)c1ccccc1NN.OCCOCCOCCO.OCCOCCOCCO.
What is the InChIKey of 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol)?
The InChIKey is MHOXNUGZOGMCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O.2C6H14O4/c8-10-6-4-2-1-3-5(6)7(12)11-9;2*7-1-3-9-5-6-10-4-2-8/h1-4,10H,8-9H2,(H,11,12);2*7-8H,1-6H2.
What are the key properties of 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol)?
2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) has a molecular weight of 466.53 g/mol, XLogP of -2.42, 16 rotatable bonds, 8 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinylbenzohydrazide;bis(2-[2-(2-hydroxyethoxy)ethoxy]ethanol) is sourced from PubChem (CID 69498053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).