C12H10Cl2F2N2OS — CID 168581259
3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2,2-difluoroethoxy)aniline (PubChem CID 168581259) has the molecular formula C12H10Cl2F2N2OS and a molecular weight of 339.19 g/mol. Its IUPAC name is 3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2,2-difluoroethoxy)aniline.
| Compound Name | 3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2,2-difluoroethoxy)aniline |
|---|---|
| PubChem CID | 168581259 |
| Molecular Formula | C12H10Cl2F2N2OS |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2,2-difluoroethoxy)aniline |
| SMILES | FC(F)COc1ccc(NCc2cnc(Cl)s2)cc1Cl |
| InChI | InChI=1S/C12H10Cl2F2N2OS/c13-9-3-7(1-2-10(9)19-6-11(15)16)17-4-8-5-18-12(14)20-8/h1-3,5,11,17H,4,6H2 |
| InChIKey | AUDRBDAWLGDRAJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|