C17H13Cl2FN2OS — CID 168584076
3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(3-fluorophenyl)methoxy]aniline (PubChem CID 168584076) has the molecular formula C17H13Cl2FN2OS and a molecular weight of 383.28 g/mol. Its IUPAC name is 3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(3-fluorophenyl)methoxy]aniline.
| Compound Name | 3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(3-fluorophenyl)methoxy]aniline |
|---|---|
| PubChem CID | 168584076 |
| Molecular Formula | C17H13Cl2FN2OS |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(3-fluorophenyl)methoxy]aniline |
| SMILES | Fc1cccc(COc2ccc(NCc3cnc(Cl)s3)cc2Cl)c1 |
| InChI | InChI=1S/C17H13Cl2FN2OS/c18-15-7-13(21-8-14-9-22-17(19)24-14)4-5-16(15)23-10-11-2-1-3-12(20)6-11/h1-7,9,21H,8,10H2 |
| InChIKey | UCDGUATYCVBDCB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|